1-(3,4-dihydroisoquinolin-2(1H)-yl)-3-(1H-pyrrol-1-yl)-3-(thiophen-2-yl)propan-1-one
Chemical Structure Depiction of
1-(3,4-dihydroisoquinolin-2(1H)-yl)-3-(1H-pyrrol-1-yl)-3-(thiophen-2-yl)propan-1-one
1-(3,4-dihydroisoquinolin-2(1H)-yl)-3-(1H-pyrrol-1-yl)-3-(thiophen-2-yl)propan-1-one
Compound characteristics
| Compound ID: | G354-0057 |
| Compound Name: | 1-(3,4-dihydroisoquinolin-2(1H)-yl)-3-(1H-pyrrol-1-yl)-3-(thiophen-2-yl)propan-1-one |
| Molecular Weight: | 336.45 |
| Molecular Formula: | C20 H20 N2 O S |
| Smiles: | C1CN(Cc2ccccc12)C(CC(c1cccs1)n1cccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8496 |
| logD: | 3.8496 |
| logSw: | -3.9686 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 20.5623 |
| InChI Key: | YCZCGUOOJDGGTL-SFHVURJKSA-N |