N-(2-phenylethyl)-3-(1H-pyrrol-1-yl)-3-(thiophen-2-yl)propanamide
Chemical Structure Depiction of
N-(2-phenylethyl)-3-(1H-pyrrol-1-yl)-3-(thiophen-2-yl)propanamide
N-(2-phenylethyl)-3-(1H-pyrrol-1-yl)-3-(thiophen-2-yl)propanamide
Compound characteristics
| Compound ID: | G354-0076 |
| Compound Name: | N-(2-phenylethyl)-3-(1H-pyrrol-1-yl)-3-(thiophen-2-yl)propanamide |
| Molecular Weight: | 324.44 |
| Molecular Formula: | C19 H20 N2 O S |
| Smiles: | C(CNC(CC(c1cccs1)n1cccc1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0762 |
| logD: | 3.0762 |
| logSw: | -3.3296 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.8209 |
| InChI Key: | AUZIOVDJRCQKGG-KRWDZBQOSA-N |