3-(4-methylphenyl)-N-(2-phenylethyl)-3-(1H-pyrrol-1-yl)propanamide
Chemical Structure Depiction of
3-(4-methylphenyl)-N-(2-phenylethyl)-3-(1H-pyrrol-1-yl)propanamide
3-(4-methylphenyl)-N-(2-phenylethyl)-3-(1H-pyrrol-1-yl)propanamide
Compound characteristics
| Compound ID: | G354-1246 |
| Compound Name: | 3-(4-methylphenyl)-N-(2-phenylethyl)-3-(1H-pyrrol-1-yl)propanamide |
| Molecular Weight: | 332.44 |
| Molecular Formula: | C22 H24 N2 O |
| Smiles: | Cc1ccc(cc1)C(CC(NCCc1ccccc1)=O)n1cccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8524 |
| logD: | 3.8524 |
| logSw: | -3.9104 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 27.8026 |
| InChI Key: | PMTCOYVMZAHNDC-NRFANRHFSA-N |