1-benzoyl-N-[(2,5-dimethoxyphenyl)methyl]-2,3-dihydro-1H-indole-2-carboxamide
Chemical Structure Depiction of
1-benzoyl-N-[(2,5-dimethoxyphenyl)methyl]-2,3-dihydro-1H-indole-2-carboxamide
1-benzoyl-N-[(2,5-dimethoxyphenyl)methyl]-2,3-dihydro-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | G366-1193 |
| Compound Name: | 1-benzoyl-N-[(2,5-dimethoxyphenyl)methyl]-2,3-dihydro-1H-indole-2-carboxamide |
| Molecular Weight: | 416.48 |
| Molecular Formula: | C25 H24 N2 O4 |
| Smiles: | COc1ccc(c(CNC(C2Cc3ccccc3N2C(c2ccccc2)=O)=O)c1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5972 |
| logD: | 3.5972 |
| logSw: | -3.8358 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.853 |
| InChI Key: | CHBVMMNEKUPXQN-QFIPXVFZSA-N |