methyl 3-[(4-oxo-3,4-dihydrospiro[[1,3]benzoxazine-2,4'-piperidine]-1'-carbonyl)amino]thiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-[(4-oxo-3,4-dihydrospiro[[1,3]benzoxazine-2,4'-piperidine]-1'-carbonyl)amino]thiophene-2-carboxylate
methyl 3-[(4-oxo-3,4-dihydrospiro[[1,3]benzoxazine-2,4'-piperidine]-1'-carbonyl)amino]thiophene-2-carboxylate
Compound characteristics
| Compound ID: | G368-0081 |
| Compound Name: | methyl 3-[(4-oxo-3,4-dihydrospiro[[1,3]benzoxazine-2,4'-piperidine]-1'-carbonyl)amino]thiophene-2-carboxylate |
| Molecular Weight: | 401.44 |
| Molecular Formula: | C19 H19 N3 O5 S |
| Smiles: | COC(c1c(ccs1)NC(N1CCC2(CC1)NC(c1ccccc1O2)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0402 |
| logD: | 2.0384 |
| logSw: | -2.9478 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.437 |
| InChI Key: | RMFFIXWISDSASZ-UHFFFAOYSA-N |