N-{4-[(3-ethoxypropyl)carbamoyl]phenyl}-5,6-dihydro-1,4-oxathiine-2-carboxamide
Chemical Structure Depiction of
N-{4-[(3-ethoxypropyl)carbamoyl]phenyl}-5,6-dihydro-1,4-oxathiine-2-carboxamide
N-{4-[(3-ethoxypropyl)carbamoyl]phenyl}-5,6-dihydro-1,4-oxathiine-2-carboxamide
Compound characteristics
| Compound ID: | G370-0166 |
| Compound Name: | N-{4-[(3-ethoxypropyl)carbamoyl]phenyl}-5,6-dihydro-1,4-oxathiine-2-carboxamide |
| Molecular Weight: | 350.43 |
| Molecular Formula: | C17 H22 N2 O4 S |
| Smiles: | CCOCCCNC(c1ccc(cc1)NC(C1=CSCCO1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3605 |
| logD: | 1.1966 |
| logSw: | -2.2693 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.462 |
| InChI Key: | ZWCIPKICTJPLSW-UHFFFAOYSA-N |