N-(3-{[(4-fluorophenyl)methyl]carbamoyl}phenyl)-5,6-dihydro-1,4-oxathiine-2-carboxamide
Chemical Structure Depiction of
N-(3-{[(4-fluorophenyl)methyl]carbamoyl}phenyl)-5,6-dihydro-1,4-oxathiine-2-carboxamide
N-(3-{[(4-fluorophenyl)methyl]carbamoyl}phenyl)-5,6-dihydro-1,4-oxathiine-2-carboxamide
Compound characteristics
| Compound ID: | G370-0491 |
| Compound Name: | N-(3-{[(4-fluorophenyl)methyl]carbamoyl}phenyl)-5,6-dihydro-1,4-oxathiine-2-carboxamide |
| Molecular Weight: | 372.42 |
| Molecular Formula: | C19 H17 F N2 O3 S |
| Smiles: | C(c1ccc(cc1)F)NC(c1cccc(c1)NC(C1=CSCCO1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6944 |
| logD: | 2.6914 |
| logSw: | -3.0911 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.372 |
| InChI Key: | YSMCGQQIFSXJDV-UHFFFAOYSA-N |