2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1H-isoindole-1,3(2H)-dione
Chemical Structure Depiction of
2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1H-isoindole-1,3(2H)-dione
2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1H-isoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | G373-0041 |
| Compound Name: | 2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1H-isoindole-1,3(2H)-dione |
| Molecular Weight: | 318.33 |
| Molecular Formula: | C19 H14 N2 O3 |
| Smiles: | Cc1c(CN2C(c3ccccc3C2=O)=O)nc(c2ccccc2)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.1821 |
| logD: | 3.1821 |
| logSw: | -3.3983 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.613 |
| InChI Key: | OPTYUGREGIRKGR-UHFFFAOYSA-N |