(4-{[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}piperazin-1-yl)(4-methylphenyl)methanone
Chemical Structure Depiction of
(4-{[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}piperazin-1-yl)(4-methylphenyl)methanone
(4-{[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}piperazin-1-yl)(4-methylphenyl)methanone
Compound characteristics
| Compound ID: | G373-0915 |
| Compound Name: | (4-{[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}piperazin-1-yl)(4-methylphenyl)methanone |
| Molecular Weight: | 405.5 |
| Molecular Formula: | C24 H27 N3 O3 |
| Smiles: | Cc1ccc(cc1)C(N1CCN(CC1)Cc1c(C)oc(c2ccc(cc2)OC)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3846 |
| logD: | 3.3843 |
| logSw: | -3.3127 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.093 |
| InChI Key: | HRZCPRIRGSCJOO-UHFFFAOYSA-N |