N-(2-methoxyphenyl)-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]piperazine-1-carboxamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]piperazine-1-carboxamide
N-(2-methoxyphenyl)-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]piperazine-1-carboxamide
Compound characteristics
| Compound ID: | G373-1088 |
| Compound Name: | N-(2-methoxyphenyl)-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]piperazine-1-carboxamide |
| Molecular Weight: | 406.48 |
| Molecular Formula: | C23 H26 N4 O3 |
| Smiles: | Cc1c(CN2CCN(CC2)C(Nc2ccccc2OC)=O)nc(c2ccccc2)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.3832 |
| logD: | 3.375 |
| logSw: | -3.6224 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.303 |
| InChI Key: | NWUZCWMKTBPCAF-UHFFFAOYSA-N |