1-{2-[(3,4-dimethylphenyl)carbamamido]ethyl}-N,N-dimethyl-1H-benzotriazole-5-carboxamide
					Chemical Structure Depiction of
1-{2-[(3,4-dimethylphenyl)carbamamido]ethyl}-N,N-dimethyl-1H-benzotriazole-5-carboxamide
			1-{2-[(3,4-dimethylphenyl)carbamamido]ethyl}-N,N-dimethyl-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | G373-1889 | 
| Compound Name: | 1-{2-[(3,4-dimethylphenyl)carbamamido]ethyl}-N,N-dimethyl-1H-benzotriazole-5-carboxamide | 
| Molecular Weight: | 380.45 | 
| Molecular Formula: | C20 H24 N6 O2 | 
| Smiles: | Cc1ccc(cc1C)NC(NCCn1c2ccc(cc2nn1)C(N(C)C)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.8313 | 
| logD: | 1.8313 | 
| logSw: | -2.3432 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 75.382 | 
| InChI Key: | DEYLIKKPITWAEX-UHFFFAOYSA-N | 
 
				 
				