tert-butyl {2-[2-amino-4-(pyrrolidine-1-sulfonyl)anilino]ethyl}carbamate
Chemical Structure Depiction of
tert-butyl {2-[2-amino-4-(pyrrolidine-1-sulfonyl)anilino]ethyl}carbamate
tert-butyl {2-[2-amino-4-(pyrrolidine-1-sulfonyl)anilino]ethyl}carbamate
Compound characteristics
| Compound ID: | G373-2804 |
| Compound Name: | tert-butyl {2-[2-amino-4-(pyrrolidine-1-sulfonyl)anilino]ethyl}carbamate |
| Molecular Weight: | 384.5 |
| Molecular Formula: | C17 H28 N4 O4 S |
| Smiles: | CC(C)(C)OC(NCCNc1ccc(cc1N)S(N1CCCC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4119 |
| logD: | 2.4111 |
| logSw: | -2.9088 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 93.778 |
| InChI Key: | GVCGBAJNMPDZGW-UHFFFAOYSA-N |