1-[(4-methylphenyl)methyl]-N-(naphthalen-1-yl)-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
1-[(4-methylphenyl)methyl]-N-(naphthalen-1-yl)-1H-benzotriazole-5-carboxamide
1-[(4-methylphenyl)methyl]-N-(naphthalen-1-yl)-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | G373-3087 |
| Compound Name: | 1-[(4-methylphenyl)methyl]-N-(naphthalen-1-yl)-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 392.46 |
| Molecular Formula: | C25 H20 N4 O |
| Smiles: | Cc1ccc(Cn2c3ccc(cc3nn2)C(Nc2cccc3ccccc23)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.5876 |
| logD: | 4.5872 |
| logSw: | -4.8306 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.786 |
| InChI Key: | JBBAJIHFQIUBGQ-UHFFFAOYSA-N |