5-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-2-phenyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
Chemical Structure Depiction of
5-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-2-phenyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
5-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-2-phenyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
Compound characteristics
| Compound ID: | G374-0032 |
| Compound Name: | 5-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-2-phenyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one |
| Molecular Weight: | 396.44 |
| Molecular Formula: | C21 H24 N4 O4 |
| Smiles: | C1CN(CCC12OCCO2)C(CN1CCn2c(cc(c3ccccc3)n2)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.8874 |
| logD: | 0.8874 |
| logSw: | -1.6108 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 60.608 |
| InChI Key: | PYWJONDSEAXPLN-UHFFFAOYSA-N |