1-(4-chlorophenyl)-N-[(quinoxalin-6-yl)methyl]methanamine
Chemical Structure Depiction of
1-(4-chlorophenyl)-N-[(quinoxalin-6-yl)methyl]methanamine
1-(4-chlorophenyl)-N-[(quinoxalin-6-yl)methyl]methanamine
Compound characteristics
| Compound ID: | G377-0016 |
| Compound Name: | 1-(4-chlorophenyl)-N-[(quinoxalin-6-yl)methyl]methanamine |
| Molecular Weight: | 283.76 |
| Molecular Formula: | C16 H14 Cl N3 |
| Smiles: | C(c1ccc(cc1)[Cl])NCc1ccc2c(c1)nccn2 |
| Stereo: | ACHIRAL |
| logP: | 2.7815 |
| logD: | 2.7429 |
| logSw: | -3.4096 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.8014 |
| InChI Key: | CDBLXGKWIBFXSO-UHFFFAOYSA-N |