5-[3-({[(4-butoxyphenyl)methyl]amino}methyl)-1H-indol-1-yl]thiophene-2-carboxylic acid
Chemical Structure Depiction of
5-[3-({[(4-butoxyphenyl)methyl]amino}methyl)-1H-indol-1-yl]thiophene-2-carboxylic acid
5-[3-({[(4-butoxyphenyl)methyl]amino}methyl)-1H-indol-1-yl]thiophene-2-carboxylic acid
Compound characteristics
| Compound ID: | G381-0256 |
| Compound Name: | 5-[3-({[(4-butoxyphenyl)methyl]amino}methyl)-1H-indol-1-yl]thiophene-2-carboxylic acid |
| Molecular Weight: | 434.56 |
| Molecular Formula: | C25 H26 N2 O3 S |
| Smiles: | CCCCOc1ccc(CNCc2cn(c3ccccc23)c2ccc(C(O)=O)s2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.8672 |
| logD: | 5.8672 |
| logSw: | -5.3645 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.391 |
| InChI Key: | LOEMAEQQMSBTOI-UHFFFAOYSA-N |