N-[2-(4-methylphenyl)ethyl]-5-(piperidine-1-sulfonyl)-1-propanoyl-2,3-dihydro-1H-indole-2-carboxamide
Chemical Structure Depiction of
N-[2-(4-methylphenyl)ethyl]-5-(piperidine-1-sulfonyl)-1-propanoyl-2,3-dihydro-1H-indole-2-carboxamide
N-[2-(4-methylphenyl)ethyl]-5-(piperidine-1-sulfonyl)-1-propanoyl-2,3-dihydro-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | G384-1244 |
| Compound Name: | N-[2-(4-methylphenyl)ethyl]-5-(piperidine-1-sulfonyl)-1-propanoyl-2,3-dihydro-1H-indole-2-carboxamide |
| Molecular Weight: | 483.63 |
| Molecular Formula: | C26 H33 N3 O4 S |
| Smiles: | CCC(N1C(Cc2cc(ccc12)S(N1CCCCC1)(=O)=O)C(NCCc1ccc(C)cc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.424 |
| logD: | 3.424 |
| logSw: | -3.8434 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.975 |
| InChI Key: | OLVMGGKWCVQCNM-XMMPIXPASA-N |