N-[2-(azepan-1-yl)ethyl]-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide
Chemical Structure Depiction of
N-[2-(azepan-1-yl)ethyl]-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide
N-[2-(azepan-1-yl)ethyl]-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide
Compound characteristics
| Compound ID: | G394-0241 |
| Compound Name: | N-[2-(azepan-1-yl)ethyl]-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide |
| Molecular Weight: | 416.59 |
| Molecular Formula: | C21 H32 N6 O S |
| Smiles: | Cc1c2c(ncnc2sc1C(NCCN1CCCCCC1)=O)N1CCN(C)CC1 |
| Stereo: | ACHIRAL |
| logP: | 2.8631 |
| logD: | 1.5974 |
| logSw: | -3.1439 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.583 |
| InChI Key: | BFEBGWDCTDTDAZ-UHFFFAOYSA-N |