1-[(3-chlorophenyl)methyl]-4-({[(furan-2-yl)methyl]amino}methyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
1-[(3-chlorophenyl)methyl]-4-({[(furan-2-yl)methyl]amino}methyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
1-[(3-chlorophenyl)methyl]-4-({[(furan-2-yl)methyl]amino}methyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
Compound characteristics
| Compound ID: | G396-0687 |
| Compound Name: | 1-[(3-chlorophenyl)methyl]-4-({[(furan-2-yl)methyl]amino}methyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 372.85 |
| Molecular Formula: | C20 H21 Cl N2 O3 |
| Smiles: | Cc1c(CNCc2ccco2)c(C(O)=O)c(C)n1Cc1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.8094 |
| logD: | 3.8094 |
| logSw: | -4.3004 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.859 |
| InChI Key: | QGXKTOSDDQXTIW-UHFFFAOYSA-N |