4-({[2-(2-chlorophenyl)ethyl]amino}methyl)-2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
4-({[2-(2-chlorophenyl)ethyl]amino}methyl)-2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid
4-({[2-(2-chlorophenyl)ethyl]amino}methyl)-2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid
Compound characteristics
| Compound ID: | G396-2315 |
| Compound Name: | 4-({[2-(2-chlorophenyl)ethyl]amino}methyl)-2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 396.92 |
| Molecular Formula: | C23 H25 Cl N2 O2 |
| Smiles: | Cc1ccc(cc1)n1c(C)c(CNCCc2ccccc2[Cl])c(C(O)=O)c1C |
| Stereo: | ACHIRAL |
| logP: | 4.5415 |
| logD: | 4.5415 |
| logSw: | -4.385 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.695 |
| InChI Key: | IHYBJVAXLMTGEK-UHFFFAOYSA-N |