2,5-dimethyl-1-phenyl-4-{[(3-phenylpropyl)amino]methyl}-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
2,5-dimethyl-1-phenyl-4-{[(3-phenylpropyl)amino]methyl}-1H-pyrrole-3-carboxylic acid
2,5-dimethyl-1-phenyl-4-{[(3-phenylpropyl)amino]methyl}-1H-pyrrole-3-carboxylic acid
Compound characteristics
| Compound ID: | G396-3297 |
| Compound Name: | 2,5-dimethyl-1-phenyl-4-{[(3-phenylpropyl)amino]methyl}-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 362.47 |
| Molecular Formula: | C23 H26 N2 O2 |
| Smiles: | Cc1c(CNCCCc2ccccc2)c(C(O)=O)c(C)n1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.0793 |
| logD: | 4.0793 |
| logSw: | -4.3455 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.695 |
| InChI Key: | OWNUTCKEEHITTD-UHFFFAOYSA-N |