1-(4-{4-[4-(2-methyl-1,3-oxazol-5-yl)benzene-1-sulfonyl]piperazin-1-yl}phenyl)ethan-1-one
Chemical Structure Depiction of
1-(4-{4-[4-(2-methyl-1,3-oxazol-5-yl)benzene-1-sulfonyl]piperazin-1-yl}phenyl)ethan-1-one
1-(4-{4-[4-(2-methyl-1,3-oxazol-5-yl)benzene-1-sulfonyl]piperazin-1-yl}phenyl)ethan-1-one
Compound characteristics
| Compound ID: | G408-0118 |
| Compound Name: | 1-(4-{4-[4-(2-methyl-1,3-oxazol-5-yl)benzene-1-sulfonyl]piperazin-1-yl}phenyl)ethan-1-one |
| Molecular Weight: | 425.51 |
| Molecular Formula: | C22 H23 N3 O4 S |
| Smiles: | CC(c1ccc(cc1)N1CCN(CC1)S(c1ccc(cc1)c1cnc(C)o1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1473 |
| logD: | 3.1473 |
| logSw: | -3.1763 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 65.988 |
| InChI Key: | QXSWJTRXGJUBFQ-UHFFFAOYSA-N |