N-(2,5-diethoxyphenyl)-2-methoxy-5-(2-methyl-1,3-oxazol-5-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-(2,5-diethoxyphenyl)-2-methoxy-5-(2-methyl-1,3-oxazol-5-yl)benzene-1-sulfonamide
N-(2,5-diethoxyphenyl)-2-methoxy-5-(2-methyl-1,3-oxazol-5-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G408-1370 |
| Compound Name: | N-(2,5-diethoxyphenyl)-2-methoxy-5-(2-methyl-1,3-oxazol-5-yl)benzene-1-sulfonamide |
| Molecular Weight: | 432.49 |
| Molecular Formula: | C21 H24 N2 O6 S |
| Smiles: | CCOc1ccc(c(c1)NS(c1cc(ccc1OC)c1cnc(C)o1)(=O)=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 3.9624 |
| logD: | 2.6404 |
| logSw: | -3.9939 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.106 |
| InChI Key: | AENLPSVWSOGEAG-UHFFFAOYSA-N |