5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(3,5-dimethoxyphenyl)-2-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(3,5-dimethoxyphenyl)-2-methylbenzene-1-sulfonamide
5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(3,5-dimethoxyphenyl)-2-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | G408-2427 |
| Compound Name: | 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(3,5-dimethoxyphenyl)-2-methylbenzene-1-sulfonamide |
| Molecular Weight: | 414.48 |
| Molecular Formula: | C21 H22 N2 O5 S |
| Smiles: | Cc1ccc(cc1S(Nc1cc(cc(c1)OC)OC)(=O)=O)c1cnc(C2CC2)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.6919 |
| logD: | 3.1236 |
| logSw: | -4.3035 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.951 |
| InChI Key: | RCLNSNZXJMJURO-UHFFFAOYSA-N |