5-(2-cyclopropyl-1,3-oxazol-5-yl)-2-methyl-N-(2,4,6-trimethylphenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
5-(2-cyclopropyl-1,3-oxazol-5-yl)-2-methyl-N-(2,4,6-trimethylphenyl)benzene-1-sulfonamide
5-(2-cyclopropyl-1,3-oxazol-5-yl)-2-methyl-N-(2,4,6-trimethylphenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G408-2497 |
| Compound Name: | 5-(2-cyclopropyl-1,3-oxazol-5-yl)-2-methyl-N-(2,4,6-trimethylphenyl)benzene-1-sulfonamide |
| Molecular Weight: | 396.51 |
| Molecular Formula: | C22 H24 N2 O3 S |
| Smiles: | Cc1cc(C)c(c(C)c1)NS(c1cc(ccc1C)c1cnc(C2CC2)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3274 |
| logD: | 4.9163 |
| logSw: | -5.2654 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.467 |
| InChI Key: | SMYBKEFYPLKNJR-UHFFFAOYSA-N |