N-(2,5-diethoxyphenyl)-5-(3,4-dimethyl-1,2-oxazol-5-yl)furan-2-sulfonamide
Chemical Structure Depiction of
N-(2,5-diethoxyphenyl)-5-(3,4-dimethyl-1,2-oxazol-5-yl)furan-2-sulfonamide
N-(2,5-diethoxyphenyl)-5-(3,4-dimethyl-1,2-oxazol-5-yl)furan-2-sulfonamide
Compound characteristics
| Compound ID: | G408-2956 |
| Compound Name: | N-(2,5-diethoxyphenyl)-5-(3,4-dimethyl-1,2-oxazol-5-yl)furan-2-sulfonamide |
| Molecular Weight: | 406.46 |
| Molecular Formula: | C19 H22 N2 O6 S |
| Smiles: | CCOc1ccc(c(c1)NS(c1ccc(c2c(C)c(C)no2)o1)(=O)=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 4.1911 |
| logD: | 2.6961 |
| logSw: | -4.2234 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.761 |
| InChI Key: | SOCLGKMFJJHODX-UHFFFAOYSA-N |