N~6~-{2-[bis(2-methylpropyl)amino]ethyl}-N~4~-(4-methoxyphenyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine
Chemical Structure Depiction of
N~6~-{2-[bis(2-methylpropyl)amino]ethyl}-N~4~-(4-methoxyphenyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine
N~6~-{2-[bis(2-methylpropyl)amino]ethyl}-N~4~-(4-methoxyphenyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine
Compound characteristics
| Compound ID: | G414-0298 |
| Compound Name: | N~6~-{2-[bis(2-methylpropyl)amino]ethyl}-N~4~-(4-methoxyphenyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine |
| Molecular Weight: | 425.58 |
| Molecular Formula: | C23 H35 N7 O |
| Smiles: | CC(C)CN(CCNc1nc(c2cnn(C)c2n1)Nc1ccc(cc1)OC)CC(C)C |
| Stereo: | ACHIRAL |
| logP: | 4.9031 |
| logD: | 2.9075 |
| logSw: | -4.4076 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.197 |
| InChI Key: | DFPQPXDOWMWYIB-UHFFFAOYSA-N |