6-([1,4'-bipiperidin]-1'-yl)-N-[(2-methoxyphenyl)methyl]-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine--hydrogen chloride (1/1)
Chemical Structure Depiction of
6-([1,4'-bipiperidin]-1'-yl)-N-[(2-methoxyphenyl)methyl]-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine--hydrogen chloride (1/1)
6-([1,4'-bipiperidin]-1'-yl)-N-[(2-methoxyphenyl)methyl]-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | G414-1039 |
| Compound Name: | 6-([1,4'-bipiperidin]-1'-yl)-N-[(2-methoxyphenyl)methyl]-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine--hydrogen chloride (1/1) |
| Molecular Weight: | 472.03 |
| Molecular Formula: | C24 H33 N7 O |
| Salt: | HCl |
| Smiles: | Cn1c2c(cn1)c(NCc1ccccc1OC)nc(n2)N1CCC(CC1)N1CCCCC1 |
| Stereo: | ACHIRAL |
| logP: | 4.0312 |
| logD: | 1.339 |
| logSw: | -4.0406 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.636 |
| InChI Key: | XUYFCBXQPRXJAZ-UHFFFAOYSA-N |