N-(3-methoxyphenyl)-2-{[(4-methoxyphenyl)methyl]amino}-4-methylpyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(3-methoxyphenyl)-2-{[(4-methoxyphenyl)methyl]amino}-4-methylpyrimidine-5-carboxamide
N-(3-methoxyphenyl)-2-{[(4-methoxyphenyl)methyl]amino}-4-methylpyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | G415-4384 |
| Compound Name: | N-(3-methoxyphenyl)-2-{[(4-methoxyphenyl)methyl]amino}-4-methylpyrimidine-5-carboxamide |
| Molecular Weight: | 378.43 |
| Molecular Formula: | C21 H22 N4 O3 |
| Smiles: | Cc1c(cnc(NCc2ccc(cc2)OC)n1)C(Nc1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.145 |
| logD: | 3.1286 |
| logSw: | -3.3707 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.456 |
| InChI Key: | KIBGBAAPIUDURZ-UHFFFAOYSA-N |