5-[(4-bromobenzene-1-sulfonyl)amino]-N-(3,5-dimethoxyphenyl)pyridine-3-carboxamide
Chemical Structure Depiction of
5-[(4-bromobenzene-1-sulfonyl)amino]-N-(3,5-dimethoxyphenyl)pyridine-3-carboxamide
5-[(4-bromobenzene-1-sulfonyl)amino]-N-(3,5-dimethoxyphenyl)pyridine-3-carboxamide
Compound characteristics
| Compound ID: | G416-4939 |
| Compound Name: | 5-[(4-bromobenzene-1-sulfonyl)amino]-N-(3,5-dimethoxyphenyl)pyridine-3-carboxamide |
| Molecular Weight: | 492.35 |
| Molecular Formula: | C20 H18 Br N3 O5 S |
| Smiles: | COc1cc(cc(c1)OC)NC(c1cc(cnc1)NS(c1ccc(cc1)[Br])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1706 |
| logD: | 3.5973 |
| logSw: | -4.1527 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 88.674 |
| InChI Key: | IHJCIKIMBZXBED-UHFFFAOYSA-N |