N-(3-chloro-4-fluorophenyl)-3-[1-(3-fluorophenyl)-6-methoxy-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-3-[1-(3-fluorophenyl)-6-methoxy-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
N-(3-chloro-4-fluorophenyl)-3-[1-(3-fluorophenyl)-6-methoxy-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide
Compound characteristics
| Compound ID: | G427-2543 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-3-[1-(3-fluorophenyl)-6-methoxy-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl]propanamide |
| Molecular Weight: | 470.91 |
| Molecular Formula: | C24 H21 Cl F2 N4 O2 |
| Smiles: | Cc1c(CCC(Nc2ccc(c(c2)[Cl])F)=O)c(nc2c1c(C)nn2c1cccc(c1)F)OC |
| Stereo: | ACHIRAL |
| logP: | 5.5893 |
| logD: | 5.561 |
| logSw: | -6.0242 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.813 |
| InChI Key: | GZSBOZBXTUEHQO-UHFFFAOYSA-N |