2-(4-butoxyphenyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]pyrazolo[1,5-a]pyrazine
Chemical Structure Depiction of
2-(4-butoxyphenyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]pyrazolo[1,5-a]pyrazine
2-(4-butoxyphenyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]pyrazolo[1,5-a]pyrazine
Compound characteristics
| Compound ID: | G430-0796 |
| Compound Name: | 2-(4-butoxyphenyl)-4-[4-(4-fluorophenyl)piperazin-1-yl]pyrazolo[1,5-a]pyrazine |
| Molecular Weight: | 445.54 |
| Molecular Formula: | C26 H28 F N5 O |
| Smiles: | CCCCOc1ccc(cc1)c1cc2c(nccn2n1)N1CCN(CC1)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 5.96 |
| logD: | 5.9575 |
| logSw: | -5.4849 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 33.952 |
| InChI Key: | PYHCZCFGINRLLD-UHFFFAOYSA-N |