2-(4-chlorophenyl)-4-(4-cyclohexylpiperazin-1-yl)pyrazolo[1,5-a]pyrazine
Chemical Structure Depiction of
2-(4-chlorophenyl)-4-(4-cyclohexylpiperazin-1-yl)pyrazolo[1,5-a]pyrazine
2-(4-chlorophenyl)-4-(4-cyclohexylpiperazin-1-yl)pyrazolo[1,5-a]pyrazine
Compound characteristics
| Compound ID: | G430-1488 |
| Compound Name: | 2-(4-chlorophenyl)-4-(4-cyclohexylpiperazin-1-yl)pyrazolo[1,5-a]pyrazine |
| Molecular Weight: | 395.93 |
| Molecular Formula: | C22 H26 Cl N5 |
| Smiles: | C1CCC(CC1)N1CCN(CC1)c1c2cc(c3ccc(cc3)[Cl])nn2ccn1 |
| Stereo: | ACHIRAL |
| logP: | 4.9936 |
| logD: | 4.226 |
| logSw: | -5.3393 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.3678 |
| InChI Key: | KSKAFYAVOKNAJG-UHFFFAOYSA-N |