N-(1,3-diethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-N'-(3-fluoro-4-methylphenyl)urea
Chemical Structure Depiction of
N-(1,3-diethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-N'-(3-fluoro-4-methylphenyl)urea
N-(1,3-diethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-N'-(3-fluoro-4-methylphenyl)urea
Compound characteristics
| Compound ID: | G433-0579 |
| Compound Name: | N-(1,3-diethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-N'-(3-fluoro-4-methylphenyl)urea |
| Molecular Weight: | 356.4 |
| Molecular Formula: | C19 H21 F N4 O2 |
| Smiles: | CCN1C(N(CC)c2cc(ccc12)NC(Nc1ccc(C)c(c1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7753 |
| logD: | 4.7753 |
| logSw: | -4.479 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.144 |
| InChI Key: | SFJXISBUBWKZRE-UHFFFAOYSA-N |