N-(2-methoxyphenyl)-2,5-dioxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2,5-dioxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
N-(2-methoxyphenyl)-2,5-dioxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | G491-0412 |
| Compound Name: | N-(2-methoxyphenyl)-2,5-dioxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide |
| Molecular Weight: | 312.32 |
| Molecular Formula: | C17 H16 N2 O4 |
| Smiles: | COc1ccccc1NC(C1=CC2=C(CCCC2=O)NC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5991 |
| logD: | -1.6005 |
| logSw: | -2.1427 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.359 |
| InChI Key: | ZSATXXBXVPTKNL-UHFFFAOYSA-N |