5-bromo-N-[3-(1,1-dioxo-1lambda~6~,2-thiazolidin-2-yl)phenyl]furan-2-carboxamide
Chemical Structure Depiction of
5-bromo-N-[3-(1,1-dioxo-1lambda~6~,2-thiazolidin-2-yl)phenyl]furan-2-carboxamide
5-bromo-N-[3-(1,1-dioxo-1lambda~6~,2-thiazolidin-2-yl)phenyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | G498-0214 |
| Compound Name: | 5-bromo-N-[3-(1,1-dioxo-1lambda~6~,2-thiazolidin-2-yl)phenyl]furan-2-carboxamide |
| Molecular Weight: | 385.23 |
| Molecular Formula: | C14 H13 Br N2 O4 S |
| Smiles: | C1CN(c2cccc(c2)NC(c2ccc(o2)[Br])=O)S(C1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.336 |
| logD: | 2.3313 |
| logSw: | -3.0234 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.291 |
| InChI Key: | PMACSOMCNCJTMD-UHFFFAOYSA-N |