N-{2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl}acetamide
Chemical Structure Depiction of
N-{2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl}acetamide
N-{2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl}acetamide
Compound characteristics
| Compound ID: | G500-0650 |
| Compound Name: | N-{2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl}acetamide |
| Molecular Weight: | 384.5 |
| Molecular Formula: | C22 H29 F N4 O |
| Smiles: | CC(NCC(c1ccc(cc1)N(C)C)N1CCN(CC1)c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7362 |
| logD: | 2.7288 |
| logSw: | -2.9779 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.877 |
| InChI Key: | QMLINTGKJMGAHC-QFIPXVFZSA-N |