N-(2,5-dimethylphenyl)-4-(1,1-dioxo-1lambda~6~,2-thiazinan-2-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-4-(1,1-dioxo-1lambda~6~,2-thiazinan-2-yl)benzene-1-sulfonamide
N-(2,5-dimethylphenyl)-4-(1,1-dioxo-1lambda~6~,2-thiazinan-2-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G508-0165 |
| Compound Name: | N-(2,5-dimethylphenyl)-4-(1,1-dioxo-1lambda~6~,2-thiazinan-2-yl)benzene-1-sulfonamide |
| Molecular Weight: | 394.51 |
| Molecular Formula: | C18 H22 N2 O4 S2 |
| Smiles: | Cc1ccc(C)c(c1)NS(c1ccc(cc1)N1CCCCS1(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4979 |
| logD: | 2.4953 |
| logSw: | -2.9078 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.86 |
| InChI Key: | ZBMHSYGKRRSHMV-UHFFFAOYSA-N |