N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]benzamide
Chemical Structure Depiction of
N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]benzamide
N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]benzamide
Compound characteristics
| Compound ID: | G509-0183 |
| Compound Name: | N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]benzamide |
| Molecular Weight: | 403.49 |
| Molecular Formula: | C20 H18 F N O3 S2 |
| Smiles: | Cc1cc(ccc1F)S(C(CNC(c1ccccc1)=O)c1cccs1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5897 |
| logD: | 3.5897 |
| logSw: | -3.852 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.171 |
| InChI Key: | HBRITVYTLUBTOI-IBGZPJMESA-N |