N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]-2-(2-fluorophenoxy)acetamide
Chemical Structure Depiction of
N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]-2-(2-fluorophenoxy)acetamide
N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]-2-(2-fluorophenoxy)acetamide
Compound characteristics
| Compound ID: | G509-0215 |
| Compound Name: | N-[2-(4-fluoro-3-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)ethyl]-2-(2-fluorophenoxy)acetamide |
| Molecular Weight: | 451.51 |
| Molecular Formula: | C21 H19 F2 N O4 S2 |
| Smiles: | Cc1cc(ccc1F)S(C(CNC(COc1ccccc1F)=O)c1cccs1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5696 |
| logD: | 3.5696 |
| logSw: | -3.7813 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.543 |
| InChI Key: | TULWJGNIZJYFDC-FQEVSTJZSA-N |