2-(6-chloro-2-oxo-4-phenylquinazolin-1(2H)-yl)-N-[3-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-(6-chloro-2-oxo-4-phenylquinazolin-1(2H)-yl)-N-[3-(trifluoromethyl)phenyl]acetamide
2-(6-chloro-2-oxo-4-phenylquinazolin-1(2H)-yl)-N-[3-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | G515-0121 |
| Compound Name: | 2-(6-chloro-2-oxo-4-phenylquinazolin-1(2H)-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 457.84 |
| Molecular Formula: | C23 H15 Cl F3 N3 O2 |
| Smiles: | C(C(Nc1cccc(c1)C(F)(F)F)=O)N1C(N=C(c2ccccc2)c2cc(ccc12)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.9863 |
| logD: | 4.9829 |
| logSw: | -5.044 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.247 |
| InChI Key: | SEHNCZNTIPYHPK-UHFFFAOYSA-N |