2-(6-chloro-2-oxo-4-phenylquinazolin-1(2H)-yl)-N-(4-fluoro-2-methylphenyl)acetamide
Chemical Structure Depiction of
2-(6-chloro-2-oxo-4-phenylquinazolin-1(2H)-yl)-N-(4-fluoro-2-methylphenyl)acetamide
2-(6-chloro-2-oxo-4-phenylquinazolin-1(2H)-yl)-N-(4-fluoro-2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | G515-0164 |
| Compound Name: | 2-(6-chloro-2-oxo-4-phenylquinazolin-1(2H)-yl)-N-(4-fluoro-2-methylphenyl)acetamide |
| Molecular Weight: | 421.86 |
| Molecular Formula: | C23 H17 Cl F N3 O2 |
| Smiles: | Cc1cc(ccc1NC(CN1C(N=C(c2ccccc2)c2cc(ccc12)[Cl])=O)=O)F |
| Stereo: | ACHIRAL |
| logP: | 3.962 |
| logD: | 3.9588 |
| logSw: | -4.3153 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.549 |
| InChI Key: | DYUIVQDSXOPWQG-UHFFFAOYSA-N |