N-(4-fluorophenyl)-2-(4-methoxyphenyl)-N-methylquinazolin-4-amine
Chemical Structure Depiction of
N-(4-fluorophenyl)-2-(4-methoxyphenyl)-N-methylquinazolin-4-amine
N-(4-fluorophenyl)-2-(4-methoxyphenyl)-N-methylquinazolin-4-amine
Compound characteristics
| Compound ID: | G516-0253 |
| Compound Name: | N-(4-fluorophenyl)-2-(4-methoxyphenyl)-N-methylquinazolin-4-amine |
| Molecular Weight: | 359.4 |
| Molecular Formula: | C22 H18 F N3 O |
| Smiles: | CN(c1ccc(cc1)F)c1c2ccccc2nc(c2ccc(cc2)OC)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.7842 |
| logD: | 5.6296 |
| logSw: | -6.0186 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 27.903 |
| InChI Key: | HXAMBXCIJDUUBQ-UHFFFAOYSA-N |