2-(4-chlorophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]quinazolin-4-amine
Chemical Structure Depiction of
2-(4-chlorophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]quinazolin-4-amine
2-(4-chlorophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]quinazolin-4-amine
Compound characteristics
| Compound ID: | G516-1346 |
| Compound Name: | 2-(4-chlorophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]quinazolin-4-amine |
| Molecular Weight: | 447.96 |
| Molecular Formula: | C26 H26 Cl N3 O2 |
| Smiles: | CCOc1ccc(CCNc2c3ccccc3nc(c3ccc(cc3)[Cl])n2)cc1OCC |
| Stereo: | ACHIRAL |
| logP: | 6.55 |
| logD: | 6.2839 |
| logSw: | -6.5236 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.389 |
| InChI Key: | OFANILGLBKGPLP-UHFFFAOYSA-N |