2-(4-chlorophenyl)-N-(3-methylbutyl)quinazolin-4-amine
Chemical Structure Depiction of
2-(4-chlorophenyl)-N-(3-methylbutyl)quinazolin-4-amine
2-(4-chlorophenyl)-N-(3-methylbutyl)quinazolin-4-amine
Compound characteristics
| Compound ID: | G516-1351 |
| Compound Name: | 2-(4-chlorophenyl)-N-(3-methylbutyl)quinazolin-4-amine |
| Molecular Weight: | 325.84 |
| Molecular Formula: | C19 H20 Cl N3 |
| Smiles: | CC(C)CCNc1c2ccccc2nc(c2ccc(cc2)[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 6.6346 |
| logD: | 6.3685 |
| logSw: | -6.769 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.2404 |
| InChI Key: | ZSJAOODJCQNBIM-UHFFFAOYSA-N |