ethyl 4-(3-fluorophenoxy)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate
Chemical Structure Depiction of
ethyl 4-(3-fluorophenoxy)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate
ethyl 4-(3-fluorophenoxy)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | G517-0121 |
| Compound Name: | ethyl 4-(3-fluorophenoxy)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| Molecular Weight: | 332.35 |
| Molecular Formula: | C16 H13 F N2 O3 S |
| Smiles: | CCOC(c1c(C)c2c(ncnc2s1)Oc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3161 |
| logD: | 4.3161 |
| logSw: | -4.622 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.412 |
| InChI Key: | ITIRYZDKVWFDOS-UHFFFAOYSA-N |