ethyl 4-(4-fluorophenoxy)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate
Chemical Structure Depiction of
ethyl 4-(4-fluorophenoxy)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate
ethyl 4-(4-fluorophenoxy)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | G517-0151 |
| Compound Name: | ethyl 4-(4-fluorophenoxy)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate |
| Molecular Weight: | 346.38 |
| Molecular Formula: | C17 H15 F N2 O3 S |
| Smiles: | CCOC(c1c(C)c2c(nc(C)nc2s1)Oc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.619 |
| logD: | 4.6189 |
| logSw: | -4.6242 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.786 |
| InChI Key: | JRKWQRXFGHLHGD-UHFFFAOYSA-N |