ethyl 5-methyl-4-(4-methylphenoxy)thieno[2,3-d]pyrimidine-6-carboxylate
Chemical Structure Depiction of
ethyl 5-methyl-4-(4-methylphenoxy)thieno[2,3-d]pyrimidine-6-carboxylate
ethyl 5-methyl-4-(4-methylphenoxy)thieno[2,3-d]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | G517-0187 |
| Compound Name: | ethyl 5-methyl-4-(4-methylphenoxy)thieno[2,3-d]pyrimidine-6-carboxylate |
| Molecular Weight: | 328.39 |
| Molecular Formula: | C17 H16 N2 O3 S |
| Smiles: | CCOC(c1c(C)c2c(ncnc2s1)Oc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7165 |
| logD: | 4.7165 |
| logSw: | -4.7057 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.412 |
| InChI Key: | AYVLDMSZBNKXNX-UHFFFAOYSA-N |