4-(3,5-dimethylphenoxy)-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
Chemical Structure Depiction of
4-(3,5-dimethylphenoxy)-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
4-(3,5-dimethylphenoxy)-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
Compound characteristics
| Compound ID: | G517-0275 |
| Compound Name: | 4-(3,5-dimethylphenoxy)-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine |
| Molecular Weight: | 324.44 |
| Molecular Formula: | C19 H20 N2 O S |
| Smiles: | Cc1cc(C)cc(c1)Oc1c2c3CCCCc3sc2nc(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.8115 |
| logD: | 5.8115 |
| logSw: | -5.6753 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.953 |
| InChI Key: | SFQKDTDNIGOGAR-UHFFFAOYSA-N |