N-benzyl-5-{[N-benzyl(4-fluorophenyl)carbamamido]methyl}furan-2-carboxamide
Chemical Structure Depiction of
N-benzyl-5-{[N-benzyl(4-fluorophenyl)carbamamido]methyl}furan-2-carboxamide
N-benzyl-5-{[N-benzyl(4-fluorophenyl)carbamamido]methyl}furan-2-carboxamide
Compound characteristics
| Compound ID: | G521-0424 |
| Compound Name: | N-benzyl-5-{[N-benzyl(4-fluorophenyl)carbamamido]methyl}furan-2-carboxamide |
| Molecular Weight: | 457.5 |
| Molecular Formula: | C27 H24 F N3 O3 |
| Smiles: | C(c1ccccc1)NC(c1ccc(CN(Cc2ccccc2)C(Nc2ccc(cc2)F)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7815 |
| logD: | 4.7815 |
| logSw: | -4.7577 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.253 |
| InChI Key: | XUQVTGXPJHXJLE-UHFFFAOYSA-N |